C16H24FN3O — CID 78930853
(1S)-1-[5-fluoro-2-(3-morpholin-4-ylpyrrolidin-1-yl)phenyl]ethanamine (PubChem CID 78930853) has the molecular formula C16H24FN3O and a molecular weight of 293.39 g/mol. Its IUPAC name is (1S)-1-[5-fluoro-2-(3-morpholin-4-ylpyrrolidin-1-yl)phenyl]ethanamine.
| Compound Name | (1S)-1-[5-fluoro-2-(3-morpholin-4-ylpyrrolidin-1-yl)phenyl]ethanamine |
|---|---|
| PubChem CID | 78930853 |
| Molecular Formula | C16H24FN3O |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | (1S)-1-[5-fluoro-2-(3-morpholin-4-ylpyrrolidin-1-yl)phenyl]ethanamine |
| SMILES | C[C@H](N)c1cc(F)ccc1N1CCC(N2CCOCC2)C1 |
| InChI | InChI=1S/C16H24FN3O/c1-12(18)15-10-13(17)2-3-16(15)20-5-4-14(11-20)19-6-8-21-9-7-19/h2-3,10,12,14H,4-9,11,18H2,1H3/t12-,14?/m0/s1 |
| InChIKey | BBKRDMUWAMTCAJ-NBFOIZRFSA-N |
| XLogP | 1.76 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |