C15H23NO4 — CID 78931101
2-[4-[(1S)-1-hydroxyethyl]-2-methoxyphenoxy]-N-propan-2-ylpropanamide (PubChem CID 78931101) has the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. Its IUPAC name is 2-[4-[(1S)-1-hydroxyethyl]-2-methoxyphenoxy]-N-propan-2-ylpropanamide.
| Compound Name | 2-[4-[(1S)-1-hydroxyethyl]-2-methoxyphenoxy]-N-propan-2-ylpropanamide |
|---|---|
| PubChem CID | 78931101 |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 2-[4-[(1S)-1-hydroxyethyl]-2-methoxyphenoxy]-N-propan-2-ylpropanamide |
| SMILES | COc1cc([C@H](C)O)ccc1OC(C)C(=O)NC(C)C |
| InChI | InChI=1S/C15H23NO4/c1-9(2)16-15(18)11(4)20-13-7-6-12(10(3)17)8-14(13)19-5/h6-11,17H,1-5H3,(H,16,18)/t10-,11?/m0/s1 |
| InChIKey | MAVPETPOYAKVNF-VUWPPUDQSA-N |
| XLogP | 2.04 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |