C18H22O2 — CID 78931588
(1S)-1-[2-[(2,4,6-trimethylphenyl)methoxy]phenyl]ethanol (PubChem CID 78931588) has the molecular formula C18H22O2 and a molecular weight of 270.37 g/mol. Its IUPAC name is (1S)-1-[2-[(2,4,6-trimethylphenyl)methoxy]phenyl]ethanol.
| Compound Name | (1S)-1-[2-[(2,4,6-trimethylphenyl)methoxy]phenyl]ethanol |
|---|---|
| PubChem CID | 78931588 |
| Molecular Formula | C18H22O2 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | (1S)-1-[2-[(2,4,6-trimethylphenyl)methoxy]phenyl]ethanol |
| SMILES | Cc1cc(C)c(COc2ccccc2[C@H](C)O)c(C)c1 |
| InChI | InChI=1S/C18H22O2/c1-12-9-13(2)17(14(3)10-12)11-20-18-8-6-5-7-16(18)15(4)19/h5-10,15,19H,11H2,1-4H3/t15-/m0/s1 |
| InChIKey | NENFYKNZEJJDJJ-HNNXBMFYSA-N |
| XLogP | 4.24 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |