C11H15F2NO2 — CID 78932669
(1S)-1-[4-(2,2-difluoroethoxy)-3-methoxyphenyl]ethanamine (PubChem CID 78932669) has the molecular formula C11H15F2NO2 and a molecular weight of 231.24 g/mol. Its IUPAC name is (1S)-1-[4-(2,2-difluoroethoxy)-3-methoxyphenyl]ethanamine.
| Compound Name | (1S)-1-[4-(2,2-difluoroethoxy)-3-methoxyphenyl]ethanamine |
|---|---|
| PubChem CID | 78932669 |
| Molecular Formula | C11H15F2NO2 |
| Molecular Weight | 231.24 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | (1S)-1-[4-(2,2-difluoroethoxy)-3-methoxyphenyl]ethanamine |
| SMILES | COc1cc([C@H](C)N)ccc1OCC(F)F |
| InChI | InChI=1S/C11H15F2NO2/c1-7(14)8-3-4-9(10(5-8)15-2)16-6-11(12)13/h3-5,7,11H,6,14H2,1-2H3/t7-/m0/s1 |
| InChIKey | NZMHQACQVIRVTF-ZETCQYMHSA-N |
| XLogP | 2.36 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.24 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |