C13H17ClF3NO2 — CID 78932807
(1R)-1-[5-chloro-2-[3-(2,2,2-trifluoroethoxy)propoxy]phenyl]ethanamine (PubChem CID 78932807) has the molecular formula C13H17ClF3NO2 and a molecular weight of 311.73 g/mol. Its IUPAC name is (1R)-1-[5-chloro-2-[3-(2,2,2-trifluoroethoxy)propoxy]phenyl]ethanamine.
| Compound Name | (1R)-1-[5-chloro-2-[3-(2,2,2-trifluoroethoxy)propoxy]phenyl]ethanamine |
|---|---|
| PubChem CID | 78932807 |
| Molecular Formula | C13H17ClF3NO2 |
| Molecular Weight | 311.73 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | (1R)-1-[5-chloro-2-[3-(2,2,2-trifluoroethoxy)propoxy]phenyl]ethanamine |
| SMILES | C[C@@H](N)c1cc(Cl)ccc1OCCCOCC(F)(F)F |
| InChI | InChI=1S/C13H17ClF3NO2/c1-9(18)11-7-10(14)3-4-12(11)20-6-2-5-19-8-13(15,16)17/h3-4,7,9H,2,5-6,8,18H2,1H3/t9-/m1/s1 |
| InChIKey | BMJAKUZXTYGCBO-SECBINFHSA-N |
| XLogP | 3.71 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.73 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|