C19H22N2O5S — CID 7893415
ethyl 2-[[2-(4-carbamoylphenoxy)acetyl]amino]-5-propan-2-ylthiophene-3-carboxylate (PubChem CID 7893415) has the molecular formula C19H22N2O5S and a molecular weight of 390.46 g/mol. Its IUPAC name is ethyl 2-[[2-(4-carbamoylphenoxy)acetyl]amino]-5-propan-2-ylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-(4-carbamoylphenoxy)acetyl]amino]-5-propan-2-ylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 7893415 |
| Molecular Formula | C19H22N2O5S |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | ethyl 2-[[2-(4-carbamoylphenoxy)acetyl]amino]-5-propan-2-ylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1cc(C(C)C)sc1NC(=O)COc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C19H22N2O5S/c1-4-25-19(24)14-9-15(11(2)3)27-18(14)21-16(22)10-26-13-7-5-12(6-8-13)17(20)23/h5-9,11H,4,10H2,1-3H3,(H2,20,23)(H,21,22) |
| InChIKey | WMKQUXMCLVOYHU-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |