C16H25FN2O — CID 78935385
2-[(1S)-1-aminoethyl]-N-(1-cyclopropylethyl)-4-fluoro-N-(2-methoxyethyl)aniline (PubChem CID 78935385) has the molecular formula C16H25FN2O and a molecular weight of 280.39 g/mol. Its IUPAC name is 2-[(1S)-1-aminoethyl]-N-(1-cyclopropylethyl)-4-fluoro-N-(2-methoxyethyl)aniline.
| Compound Name | 2-[(1S)-1-aminoethyl]-N-(1-cyclopropylethyl)-4-fluoro-N-(2-methoxyethyl)aniline |
|---|---|
| PubChem CID | 78935385 |
| Molecular Formula | C16H25FN2O |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | 2-[(1S)-1-aminoethyl]-N-(1-cyclopropylethyl)-4-fluoro-N-(2-methoxyethyl)aniline |
| SMILES | COCCN(c1ccc(F)cc1[C@H](C)N)C(C)C1CC1 |
| InChI | InChI=1S/C16H25FN2O/c1-11(18)15-10-14(17)6-7-16(15)19(8-9-20-3)12(2)13-4-5-13/h6-7,10-13H,4-5,8-9,18H2,1-3H3/t11-,12?/m0/s1 |
| InChIKey | OMDGOVSYPYKJAF-PXYINDEMSA-N |
| XLogP | 3.10 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |