C15H25FN2O2 — CID 78935533
2-[(1S)-1-aminoethyl]-3-fluoro-N-(2-methoxyethyl)-N-(1-methoxypropan-2-yl)aniline (PubChem CID 78935533) has the molecular formula C15H25FN2O2 and a molecular weight of 284.38 g/mol. Its IUPAC name is 2-[(1S)-1-aminoethyl]-3-fluoro-N-(2-methoxyethyl)-N-(1-methoxypropan-2-yl)aniline.
| Compound Name | 2-[(1S)-1-aminoethyl]-3-fluoro-N-(2-methoxyethyl)-N-(1-methoxypropan-2-yl)aniline |
|---|---|
| PubChem CID | 78935533 |
| Molecular Formula | C15H25FN2O2 |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | 2-[(1S)-1-aminoethyl]-3-fluoro-N-(2-methoxyethyl)-N-(1-methoxypropan-2-yl)aniline |
| SMILES | COCCN(c1cccc(F)c1[C@H](C)N)C(C)COC |
| InChI | InChI=1S/C15H25FN2O2/c1-11(10-20-4)18(8-9-19-3)14-7-5-6-13(16)15(14)12(2)17/h5-7,11-12H,8-10,17H2,1-4H3/t11?,12-/m0/s1 |
| InChIKey | NAEXJBYVXNEHQX-KIYNQFGBSA-N |
| XLogP | 2.33 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |