C17H26FNO — CID 78937921
(1S)-1-[3-fluoro-4-(3,3,5-trimethylcyclohexyl)oxyphenyl]ethanamine (PubChem CID 78937921) has the molecular formula C17H26FNO and a molecular weight of 279.40 g/mol. Its IUPAC name is (1S)-1-[3-fluoro-4-(3,3,5-trimethylcyclohexyl)oxyphenyl]ethanamine.
| Compound Name | (1S)-1-[3-fluoro-4-(3,3,5-trimethylcyclohexyl)oxyphenyl]ethanamine |
|---|---|
| PubChem CID | 78937921 |
| Molecular Formula | C17H26FNO |
| Molecular Weight | 279.40 g/mol |
| Exact Mass | 279.20 |
| IUPAC Name | (1S)-1-[3-fluoro-4-(3,3,5-trimethylcyclohexyl)oxyphenyl]ethanamine |
| SMILES | CC1CC(Oc2ccc([C@H](C)N)cc2F)CC(C)(C)C1 |
| InChI | InChI=1S/C17H26FNO/c1-11-7-14(10-17(3,4)9-11)20-16-6-5-13(12(2)19)8-15(16)18/h5-6,8,11-12,14H,7,9-10,19H2,1-4H3/t11?,12-,14?/m0/s1 |
| InChIKey | DTGVOIYRDDCOFP-LXVYMNJGSA-N |
| XLogP | 4.44 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.40 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |