About (1S)-1-[4-(4,6-dimethylpyrimidin-2-yl)sulfanyl-3-fluorophenyl]ethanamine
(1S)-1-[4-(4,6-dimethylpyrimidin-2-yl)sulfanyl-3-fluorophenyl]ethanamine (PubChem CID 78938915) has the molecular formula C14H16FN3S
and a molecular weight of 277.37 g/mol. Its IUPAC name is (1S)-1-[4-(4,6-dimethylpyrimidin-2-yl)sulfanyl-3-fluorophenyl]ethanamine.
Molecular Properties
| Compound Name | (1S)-1-[4-(4,6-dimethylpyrimidin-2-yl)sulfanyl-3-fluorophenyl]ethanamine |
| PubChem CID | 78938915 |
| Molecular Formula | C14H16FN3S |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | (1S)-1-[4-(4,6-dimethylpyrimidin-2-yl)sulfanyl-3-fluorophenyl]ethanamine |
| SMILES | Cc1cc(C)nc(Sc2ccc([C@H](C)N)cc2F)n1 |
| InChI | InChI=1S/C14H16FN3S/c1-8-6-9(2)18-14(17-8)19-13-5-4-11(10(3)16)7-12(13)15/h4-7,10H,16H2,1-3H3/t10-/m0/s1 |
| InChIKey | KSLSHMDLSMBLHV-JTQLQIEISA-N |
| XLogP | 3.40 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1S)-1-[4-(4,6-dimethylpyrimidin-2-yl)sulfanyl-3-fluorophenyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-[4-(4,6-dimethylpyrimidin-2-yl)sulfanyl-3-fluorophenyl]ethanamine?
The IUPAC name of (1S)-1-[4-(4,6-dimethylpyrimidin-2-yl)sulfanyl-3-fluorophenyl]ethanamine (CID 78938915) is (1S)-1-[4-(4,6-dimethylpyrimidin-2-yl)sulfanyl-3-fluorophenyl]ethanamine.
What is the SMILES notation for (1S)-1-[4-(4,6-dimethylpyrimidin-2-yl)sulfanyl-3-fluorophenyl]ethanamine?
The canonical SMILES for (1S)-1-[4-(4,6-dimethylpyrimidin-2-yl)sulfanyl-3-fluorophenyl]ethanamine is Cc1cc(C)nc(Sc2ccc([C@H](C)N)cc2F)n1.
What is the InChIKey of (1S)-1-[4-(4,6-dimethylpyrimidin-2-yl)sulfanyl-3-fluorophenyl]ethanamine?
The InChIKey is KSLSHMDLSMBLHV-JTQLQIEISA-N. The full InChI is InChI=1S/C14H16FN3S/c1-8-6-9(2)18-14(17-8)19-13-5-4-11(10(3)16)7-12(13)15/h4-7,10H,16H2,1-3H3/t10-/m0/s1.
What are the key properties of (1S)-1-[4-(4,6-dimethylpyrimidin-2-yl)sulfanyl-3-fluorophenyl]ethanamine?
(1S)-1-[4-(4,6-dimethylpyrimidin-2-yl)sulfanyl-3-fluorophenyl]ethanamine has a molecular weight of 277.37 g/mol, XLogP of 3.40, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-[4-(4,6-dimethylpyrimidin-2-yl)sulfanyl-3-fluorophenyl]ethanamine is sourced from PubChem (CID 78938915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).