About (1R)-1-[4-(3,5-dimethylpiperidin-1-yl)phenyl]ethanol
(1R)-1-[4-(3,5-dimethylpiperidin-1-yl)phenyl]ethanol (PubChem CID 78939318) has the molecular formula C15H23NO
and a molecular weight of 233.36 g/mol. Its IUPAC name is (1R)-1-[4-(3,5-dimethylpiperidin-1-yl)phenyl]ethanol.
Molecular Properties
| Compound Name | (1R)-1-[4-(3,5-dimethylpiperidin-1-yl)phenyl]ethanol |
| PubChem CID | 78939318 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | (1R)-1-[4-(3,5-dimethylpiperidin-1-yl)phenyl]ethanol |
| SMILES | CC1CC(C)CN(c2ccc([C@@H](C)O)cc2)C1 |
| InChI | InChI=1S/C15H23NO/c1-11-8-12(2)10-16(9-11)15-6-4-14(5-7-15)13(3)17/h4-7,11-13,17H,8-10H2,1-3H3/t11?,12?,13-/m1/s1 |
| InChIKey | FHWQDXRKZBOCIB-WXRRBKDZSA-N |
| XLogP | 3.22 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|
Analyze (1R)-1-[4-(3,5-dimethylpiperidin-1-yl)phenyl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1-[4-(3,5-dimethylpiperidin-1-yl)phenyl]ethanol?
The IUPAC name of (1R)-1-[4-(3,5-dimethylpiperidin-1-yl)phenyl]ethanol (CID 78939318) is (1R)-1-[4-(3,5-dimethylpiperidin-1-yl)phenyl]ethanol.
What is the SMILES notation for (1R)-1-[4-(3,5-dimethylpiperidin-1-yl)phenyl]ethanol?
The canonical SMILES for (1R)-1-[4-(3,5-dimethylpiperidin-1-yl)phenyl]ethanol is CC1CC(C)CN(c2ccc([C@@H](C)O)cc2)C1.
What is the InChIKey of (1R)-1-[4-(3,5-dimethylpiperidin-1-yl)phenyl]ethanol?
The InChIKey is FHWQDXRKZBOCIB-WXRRBKDZSA-N. The full InChI is InChI=1S/C15H23NO/c1-11-8-12(2)10-16(9-11)15-6-4-14(5-7-15)13(3)17/h4-7,11-13,17H,8-10H2,1-3H3/t11?,12?,13-/m1/s1.
What are the key properties of (1R)-1-[4-(3,5-dimethylpiperidin-1-yl)phenyl]ethanol?
(1R)-1-[4-(3,5-dimethylpiperidin-1-yl)phenyl]ethanol has a molecular weight of 233.36 g/mol, XLogP of 3.22, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1-[4-(3,5-dimethylpiperidin-1-yl)phenyl]ethanol is sourced from PubChem (CID 78939318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).