C14H21ClN2O2 — CID 78940689
2-[N-butyl-2-chloro-4-[(1R)-1-hydroxyethyl]anilino]acetamide (PubChem CID 78940689) has the molecular formula C14H21ClN2O2 and a molecular weight of 284.79 g/mol. Its IUPAC name is 2-[N-butyl-2-chloro-4-[(1R)-1-hydroxyethyl]anilino]acetamide.
| Compound Name | 2-[N-butyl-2-chloro-4-[(1R)-1-hydroxyethyl]anilino]acetamide |
|---|---|
| PubChem CID | 78940689 |
| Molecular Formula | C14H21ClN2O2 |
| Molecular Weight | 284.79 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 2-[N-butyl-2-chloro-4-[(1R)-1-hydroxyethyl]anilino]acetamide |
| SMILES | CCCCN(CC(N)=O)c1ccc([C@@H](C)O)cc1Cl |
| InChI | InChI=1S/C14H21ClN2O2/c1-3-4-7-17(9-14(16)19)13-6-5-11(10(2)18)8-12(13)15/h5-6,8,10,18H,3-4,7,9H2,1-2H3,(H2,16,19)/t10-/m1/s1 |
| InChIKey | DOFYZJDETIUCKJ-SNVBAGLBSA-N |
| XLogP | 2.49 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.79 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|