About (1S)-1-[2-[propan-2-yl(2,2,2-trifluoroethyl)amino]phenyl]ethanol
(1S)-1-[2-[propan-2-yl(2,2,2-trifluoroethyl)amino]phenyl]ethanol (PubChem CID 78940775) has the molecular formula C13H18F3NO
and a molecular weight of 261.29 g/mol. Its IUPAC name is (1S)-1-[2-[propan-2-yl(2,2,2-trifluoroethyl)amino]phenyl]ethanol.
Molecular Properties
| Compound Name | (1S)-1-[2-[propan-2-yl(2,2,2-trifluoroethyl)amino]phenyl]ethanol |
| PubChem CID | 78940775 |
| Molecular Formula | C13H18F3NO |
| Molecular Weight | 261.29 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | (1S)-1-[2-[propan-2-yl(2,2,2-trifluoroethyl)amino]phenyl]ethanol |
| SMILES | CC(C)N(CC(F)(F)F)c1ccccc1[C@H](C)O |
| InChI | InChI=1S/C13H18F3NO/c1-9(2)17(8-13(14,15)16)12-7-5-4-6-11(12)10(3)18/h4-7,9-10,18H,8H2,1-3H3/t10-/m0/s1 |
| InChIKey | WEHIYCIJJVGSOB-JTQLQIEISA-N |
| XLogP | 3.52 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.29 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1S)-1-[2-[propan-2-yl(2,2,2-trifluoroethyl)amino]phenyl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-[2-[propan-2-yl(2,2,2-trifluoroethyl)amino]phenyl]ethanol?
The IUPAC name of (1S)-1-[2-[propan-2-yl(2,2,2-trifluoroethyl)amino]phenyl]ethanol (CID 78940775) is (1S)-1-[2-[propan-2-yl(2,2,2-trifluoroethyl)amino]phenyl]ethanol.
What is the SMILES notation for (1S)-1-[2-[propan-2-yl(2,2,2-trifluoroethyl)amino]phenyl]ethanol?
The canonical SMILES for (1S)-1-[2-[propan-2-yl(2,2,2-trifluoroethyl)amino]phenyl]ethanol is CC(C)N(CC(F)(F)F)c1ccccc1[C@H](C)O.
What is the InChIKey of (1S)-1-[2-[propan-2-yl(2,2,2-trifluoroethyl)amino]phenyl]ethanol?
The InChIKey is WEHIYCIJJVGSOB-JTQLQIEISA-N. The full InChI is InChI=1S/C13H18F3NO/c1-9(2)17(8-13(14,15)16)12-7-5-4-6-11(12)10(3)18/h4-7,9-10,18H,8H2,1-3H3/t10-/m0/s1.
What are the key properties of (1S)-1-[2-[propan-2-yl(2,2,2-trifluoroethyl)amino]phenyl]ethanol?
(1S)-1-[2-[propan-2-yl(2,2,2-trifluoroethyl)amino]phenyl]ethanol has a molecular weight of 261.29 g/mol, XLogP of 3.52, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-[2-[propan-2-yl(2,2,2-trifluoroethyl)amino]phenyl]ethanol is sourced from PubChem (CID 78940775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).