C13H21N3O — CID 78942030
2-(tert-butylamino)-N-[(3-methyl-2-pyridinyl)methyl]acetamide (PubChem CID 78942030) has the molecular formula C13H21N3O and a molecular weight of 235.33 g/mol. Its IUPAC name is 2-(tert-butylamino)-N-[(3-methyl-2-pyridinyl)methyl]acetamide.
| Compound Name | 2-(tert-butylamino)-N-[(3-methyl-2-pyridinyl)methyl]acetamide |
|---|---|
| PubChem CID | 78942030 |
| Molecular Formula | C13H21N3O |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.17 |
| IUPAC Name | 2-(tert-butylamino)-N-[(3-methyl-2-pyridinyl)methyl]acetamide |
| SMILES | Cc1cccnc1CNC(=O)CNC(C)(C)C |
| InChI | InChI=1S/C13H21N3O/c1-10-6-5-7-14-11(10)8-15-12(17)9-16-13(2,3)4/h5-7,16H,8-9H2,1-4H3,(H,15,17) |
| InChIKey | DNLSLHBPLSBWEA-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |