C14H19BrN2O2 — CID 78942430
N-(2-bromo-4-methylphenyl)-2-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]acetamide (PubChem CID 78942430) has the molecular formula C14H19BrN2O2 and a molecular weight of 327.22 g/mol. Its IUPAC name is N-(2-bromo-4-methylphenyl)-2-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]acetamide.
| Compound Name | N-(2-bromo-4-methylphenyl)-2-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 78942430 |
| Molecular Formula | C14H19BrN2O2 |
| Molecular Weight | 327.22 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | N-(2-bromo-4-methylphenyl)-2-[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]acetamide |
| SMILES | Cc1ccc(NC(=O)CN2CCC[C@H]2CO)c(Br)c1 |
| InChI | InChI=1S/C14H19BrN2O2/c1-10-4-5-13(12(15)7-10)16-14(19)8-17-6-2-3-11(17)9-18/h4-5,7,11,18H,2-3,6,8-9H2,1H3,(H,16,19)/t11-/m0/s1 |
| InChIKey | JRCRFELYOWHGEU-NSHDSACASA-N |
| XLogP | 2.15 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.22 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |