C15H13BrCl3NO — CID 78943842
3-bromo-2-(methoxymethyl)-N-[(2,3,6-trichlorophenyl)methyl]aniline (PubChem CID 78943842) has the molecular formula C15H13BrCl3NO and a molecular weight of 409.54 g/mol. Its IUPAC name is 3-bromo-2-(methoxymethyl)-N-[(2,3,6-trichlorophenyl)methyl]aniline.
| Compound Name | 3-bromo-2-(methoxymethyl)-N-[(2,3,6-trichlorophenyl)methyl]aniline |
|---|---|
| PubChem CID | 78943842 |
| Molecular Formula | C15H13BrCl3NO |
| Molecular Weight | 409.54 g/mol |
| Exact Mass | 406.92 |
| IUPAC Name | 3-bromo-2-(methoxymethyl)-N-[(2,3,6-trichlorophenyl)methyl]aniline |
| SMILES | COCc1c(Br)cccc1NCc1c(Cl)ccc(Cl)c1Cl |
| InChI | InChI=1S/C15H13BrCl3NO/c1-21-8-10-11(16)3-2-4-14(10)20-7-9-12(17)5-6-13(18)15(9)19/h2-6,20H,7-8H2,1H3 |
| InChIKey | LTKOFFGVQKOVEC-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.54 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|