4-[cyclopropyl(3-methylbutyl)amino]-3,5-difluorobenzoic acid

C15H19F2NO2 — CID 78944310

IUPAC4-[cyclopropyl(3-methylbutyl)amino]-3,5-difluorobenzoic acid
SMILESCC(C)CCN(c1c(F)cc(C(=O)O)cc1F)C1CC1
InChIInChI=1S/C15H19F2NO2/c1-9(2)5-6-18(11-3-4-11)14-12(16)7-10(15(19)20)8-13(14)17/h7-9,11H,3-6H2,1-2H3,(H,19,20)
InChIKeyTXSNOOCPCTZBCO-UHFFFAOYSA-N
MW283.32 g/mol
LogP3.68
Rot. Bonds6

About 4-[cyclopropyl(3-methylbutyl)amino]-3,5-difluorobenzoic acid

4-[cyclopropyl(3-methylbutyl)amino]-3,5-difluorobenzoic acid (PubChem CID 78944310) has the molecular formula C15H19F2NO2 and a molecular weight of 283.32 g/mol. Its IUPAC name is 4-[cyclopropyl(3-methylbutyl)amino]-3,5-difluorobenzoic acid.

Molecular Properties

Compound Name4-[cyclopropyl(3-methylbutyl)amino]-3,5-difluorobenzoic acid
PubChem CID78944310
Molecular FormulaC15H19F2NO2
Molecular Weight283.32 g/mol
Exact Mass283.14
IUPAC Name4-[cyclopropyl(3-methylbutyl)amino]-3,5-difluorobenzoic acid
SMILESCC(C)CCN(c1c(F)cc(C(=O)O)cc1F)C1CC1
InChIInChI=1S/C15H19F2NO2/c1-9(2)5-6-18(11-3-4-11)14-12(16)7-10(15(19)20)8-13(14)17/h7-9,11H,3-6H2,1-2H3,(H,19,20)
InChIKeyTXSNOOCPCTZBCO-UHFFFAOYSA-N
XLogP3.68
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500283.32
LogP ≤ 53.68
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 4-[cyclopropyl(3-methylbutyl)amino]-3,5-difluorobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[cyclopropyl(3-methylbutyl)amino]-3,5-difluorobenzoic acid?
The IUPAC name of 4-[cyclopropyl(3-methylbutyl)amino]-3,5-difluorobenzoic acid (CID 78944310) is 4-[cyclopropyl(3-methylbutyl)amino]-3,5-difluorobenzoic acid.
What is the SMILES notation for 4-[cyclopropyl(3-methylbutyl)amino]-3,5-difluorobenzoic acid?
The canonical SMILES for 4-[cyclopropyl(3-methylbutyl)amino]-3,5-difluorobenzoic acid is CC(C)CCN(c1c(F)cc(C(=O)O)cc1F)C1CC1.
What is the InChIKey of 4-[cyclopropyl(3-methylbutyl)amino]-3,5-difluorobenzoic acid?
The InChIKey is TXSNOOCPCTZBCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19F2NO2/c1-9(2)5-6-18(11-3-4-11)14-12(16)7-10(15(19)20)8-13(14)17/h7-9,11H,3-6H2,1-2H3,(H,19,20).
What are the key properties of 4-[cyclopropyl(3-methylbutyl)amino]-3,5-difluorobenzoic acid?
4-[cyclopropyl(3-methylbutyl)amino]-3,5-difluorobenzoic acid has a molecular weight of 283.32 g/mol, XLogP of 3.68, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[cyclopropyl(3-methylbutyl)amino]-3,5-difluorobenzoic acid is sourced from PubChem (CID 78944310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).