C14H11BrCl3NO — CID 78944496
(1R)-1-[3-bromo-4-(2,4,5-trichlorophenoxy)phenyl]ethanamine (PubChem CID 78944496) has the molecular formula C14H11BrCl3NO and a molecular weight of 395.51 g/mol. Its IUPAC name is (1R)-1-[3-bromo-4-(2,4,5-trichlorophenoxy)phenyl]ethanamine.
| Compound Name | (1R)-1-[3-bromo-4-(2,4,5-trichlorophenoxy)phenyl]ethanamine |
|---|---|
| PubChem CID | 78944496 |
| Molecular Formula | C14H11BrCl3NO |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 392.91 |
| IUPAC Name | (1R)-1-[3-bromo-4-(2,4,5-trichlorophenoxy)phenyl]ethanamine |
| SMILES | C[C@@H](N)c1ccc(Oc2cc(Cl)c(Cl)cc2Cl)c(Br)c1 |
| InChI | InChI=1S/C14H11BrCl3NO/c1-7(19)8-2-3-13(9(15)4-8)20-14-6-11(17)10(16)5-12(14)18/h2-7H,19H2,1H3/t7-/m1/s1 |
| InChIKey | IBIKPJOVMVGANR-SSDOTTSWSA-N |
| XLogP | 6.22 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|