About 4-(1,3-dihydroisoindol-2-yl)-3,5-difluorobenzonitrile
4-(1,3-dihydroisoindol-2-yl)-3,5-difluorobenzonitrile (PubChem CID 78945837) has the molecular formula C15H10F2N2
and a molecular weight of 256.26 g/mol. Its IUPAC name is 4-(1,3-dihydroisoindol-2-yl)-3,5-difluorobenzonitrile.
Molecular Properties
| Compound Name | 4-(1,3-dihydroisoindol-2-yl)-3,5-difluorobenzonitrile |
| PubChem CID | 78945837 |
| Molecular Formula | C15H10F2N2 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 4-(1,3-dihydroisoindol-2-yl)-3,5-difluorobenzonitrile |
| SMILES | N#Cc1cc(F)c(N2Cc3ccccc3C2)c(F)c1 |
| InChI | InChI=1S/C15H10F2N2/c16-13-5-10(7-18)6-14(17)15(13)19-8-11-3-1-2-4-12(11)9-19/h1-6H,8-9H2 |
| InChIKey | QUEYPQWDZVQDAH-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(1,3-dihydroisoindol-2-yl)-3,5-difluorobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,3-dihydroisoindol-2-yl)-3,5-difluorobenzonitrile?
The IUPAC name of 4-(1,3-dihydroisoindol-2-yl)-3,5-difluorobenzonitrile (CID 78945837) is 4-(1,3-dihydroisoindol-2-yl)-3,5-difluorobenzonitrile.
What is the SMILES notation for 4-(1,3-dihydroisoindol-2-yl)-3,5-difluorobenzonitrile?
The canonical SMILES for 4-(1,3-dihydroisoindol-2-yl)-3,5-difluorobenzonitrile is N#Cc1cc(F)c(N2Cc3ccccc3C2)c(F)c1.
What is the InChIKey of 4-(1,3-dihydroisoindol-2-yl)-3,5-difluorobenzonitrile?
The InChIKey is QUEYPQWDZVQDAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10F2N2/c16-13-5-10(7-18)6-14(17)15(13)19-8-11-3-1-2-4-12(11)9-19/h1-6H,8-9H2.
What are the key properties of 4-(1,3-dihydroisoindol-2-yl)-3,5-difluorobenzonitrile?
4-(1,3-dihydroisoindol-2-yl)-3,5-difluorobenzonitrile has a molecular weight of 256.26 g/mol, XLogP of 3.36, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-dihydroisoindol-2-yl)-3,5-difluorobenzonitrile is sourced from PubChem (CID 78945837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).