C12H12BrNO2S2 — CID 78945902
N-[(5-bromothiophen-3-yl)methyl]-3-methoxy-N-methylthiophene-2-carboxamide (PubChem CID 78945902) has the molecular formula C12H12BrNO2S2 and a molecular weight of 346.27 g/mol. Its IUPAC name is N-[(5-bromothiophen-3-yl)methyl]-3-methoxy-N-methylthiophene-2-carboxamide.
| Compound Name | N-[(5-bromothiophen-3-yl)methyl]-3-methoxy-N-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 78945902 |
| Molecular Formula | C12H12BrNO2S2 |
| Molecular Weight | 346.27 g/mol |
| Exact Mass | 344.95 |
| IUPAC Name | N-[(5-bromothiophen-3-yl)methyl]-3-methoxy-N-methylthiophene-2-carboxamide |
| SMILES | COc1ccsc1C(=O)N(C)Cc1csc(Br)c1 |
| InChI | InChI=1S/C12H12BrNO2S2/c1-14(6-8-5-10(13)18-7-8)12(15)11-9(16-2)3-4-17-11/h3-5,7H,6H2,1-2H3 |
| InChIKey | BSIMLSMLNXKMJL-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.27 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |