C12H21N3O2 — CID 78946382
2-(2-cyanomorpholin-4-yl)-N-(2-methylbutan-2-yl)acetamide (PubChem CID 78946382) has the molecular formula C12H21N3O2 and a molecular weight of 239.32 g/mol. Its IUPAC name is 2-(2-cyanomorpholin-4-yl)-N-(2-methylbutan-2-yl)acetamide.
| Compound Name | 2-(2-cyanomorpholin-4-yl)-N-(2-methylbutan-2-yl)acetamide |
|---|---|
| PubChem CID | 78946382 |
| Molecular Formula | C12H21N3O2 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.16 |
| IUPAC Name | 2-(2-cyanomorpholin-4-yl)-N-(2-methylbutan-2-yl)acetamide |
| SMILES | CCC(C)(C)NC(=O)CN1CCOC(C#N)C1 |
| InChI | InChI=1S/C12H21N3O2/c1-4-12(2,3)14-11(16)9-15-5-6-17-10(7-13)8-15/h10H,4-6,8-9H2,1-3H3,(H,14,16) |
| InChIKey | KESQOFVLSRJPJF-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |