C13H17NO3 — CID 78947603
(3S)-3-acetamido-3-(2,3-dimethylphenyl)propanoic acid (PubChem CID 78947603) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is (3S)-3-acetamido-3-(2,3-dimethylphenyl)propanoic acid.
| Compound Name | (3S)-3-acetamido-3-(2,3-dimethylphenyl)propanoic acid |
|---|---|
| PubChem CID | 78947603 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | (3S)-3-acetamido-3-(2,3-dimethylphenyl)propanoic acid |
| SMILES | CC(=O)N[C@@H](CC(=O)O)c1cccc(C)c1C |
| InChI | InChI=1S/C13H17NO3/c1-8-5-4-6-11(9(8)2)12(7-13(16)17)14-10(3)15/h4-6,12H,7H2,1-3H3,(H,14,15)(H,16,17)/t12-/m0/s1 |
| InChIKey | HBYKKZXLPHPEKF-LBPRGKRZSA-N |
| XLogP | 1.96 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |