C12H14F3IN2OS — CID 78948674
5-iodo-N-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]thiophene-3-carboxamide (PubChem CID 78948674) has the molecular formula C12H14F3IN2OS and a molecular weight of 418.22 g/mol. Its IUPAC name is 5-iodo-N-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]thiophene-3-carboxamide.
| Compound Name | 5-iodo-N-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 78948674 |
| Molecular Formula | C12H14F3IN2OS |
| Molecular Weight | 418.22 g/mol |
| Exact Mass | 417.98 |
| IUPAC Name | 5-iodo-N-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]thiophene-3-carboxamide |
| SMILES | O=C(NCC1CCN(CC(F)(F)F)C1)c1csc(I)c1 |
| InChI | InChI=1S/C12H14F3IN2OS/c13-12(14,15)7-18-2-1-8(5-18)4-17-11(19)9-3-10(16)20-6-9/h3,6,8H,1-2,4-5,7H2,(H,17,19) |
| InChIKey | KBFBGBARCGSCJB-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.22 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|