C14H15IN2O2S — CID 78949460
5-iodo-N-(2-methoxyethyl)-N-(pyridin-2-ylmethyl)thiophene-3-carboxamide (PubChem CID 78949460) has the molecular formula C14H15IN2O2S and a molecular weight of 402.26 g/mol. Its IUPAC name is 5-iodo-N-(2-methoxyethyl)-N-(pyridin-2-ylmethyl)thiophene-3-carboxamide.
| Compound Name | 5-iodo-N-(2-methoxyethyl)-N-(pyridin-2-ylmethyl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 78949460 |
| Molecular Formula | C14H15IN2O2S |
| Molecular Weight | 402.26 g/mol |
| Exact Mass | 401.99 |
| IUPAC Name | 5-iodo-N-(2-methoxyethyl)-N-(pyridin-2-ylmethyl)thiophene-3-carboxamide |
| SMILES | COCCN(Cc1ccccn1)C(=O)c1csc(I)c1 |
| InChI | InChI=1S/C14H15IN2O2S/c1-19-7-6-17(9-12-4-2-3-5-16-12)14(18)11-8-13(15)20-10-11/h2-5,8,10H,6-7,9H2,1H3 |
| InChIKey | GUQIGUSIKKUKBE-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.26 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|