C15H16INO2S — CID 78949487
5-iodo-N-methyl-N-[[5-(2-methylcyclopropyl)furan-2-yl]methyl]thiophene-3-carboxamide (PubChem CID 78949487) has the molecular formula C15H16INO2S and a molecular weight of 401.27 g/mol. Its IUPAC name is 5-iodo-N-methyl-N-[[5-(2-methylcyclopropyl)furan-2-yl]methyl]thiophene-3-carboxamide.
| Compound Name | 5-iodo-N-methyl-N-[[5-(2-methylcyclopropyl)furan-2-yl]methyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 78949487 |
| Molecular Formula | C15H16INO2S |
| Molecular Weight | 401.27 g/mol |
| Exact Mass | 400.99 |
| IUPAC Name | 5-iodo-N-methyl-N-[[5-(2-methylcyclopropyl)furan-2-yl]methyl]thiophene-3-carboxamide |
| SMILES | CC1CC1c1ccc(CN(C)C(=O)c2csc(I)c2)o1 |
| InChI | InChI=1S/C15H16INO2S/c1-9-5-12(9)13-4-3-11(19-13)7-17(2)15(18)10-6-14(16)20-8-10/h3-4,6,8-9,12H,5,7H2,1-2H3 |
| InChIKey | WZGZZKILHRTDTQ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.27 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|