C13H9F3INO2S — CID 78949795
5-iodo-N-[[4-(trifluoromethoxy)phenyl]methyl]thiophene-3-carboxamide (PubChem CID 78949795) has the molecular formula C13H9F3INO2S and a molecular weight of 427.19 g/mol. Its IUPAC name is 5-iodo-N-[[4-(trifluoromethoxy)phenyl]methyl]thiophene-3-carboxamide.
| Compound Name | 5-iodo-N-[[4-(trifluoromethoxy)phenyl]methyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 78949795 |
| Molecular Formula | C13H9F3INO2S |
| Molecular Weight | 427.19 g/mol |
| Exact Mass | 426.94 |
| IUPAC Name | 5-iodo-N-[[4-(trifluoromethoxy)phenyl]methyl]thiophene-3-carboxamide |
| SMILES | O=C(NCc1ccc(OC(F)(F)F)cc1)c1csc(I)c1 |
| InChI | InChI=1S/C13H9F3INO2S/c14-13(15,16)20-10-3-1-8(2-4-10)6-18-12(19)9-5-11(17)21-7-9/h1-5,7H,6H2,(H,18,19) |
| InChIKey | BVOUCYWLQQSXCJ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.19 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|