C13H15IN4OS — CID 78949850
(5-iodothiophen-3-yl)-[3-(4-methyl-1,2,4-triazol-3-yl)piperidin-1-yl]methanone (PubChem CID 78949850) has the molecular formula C13H15IN4OS and a molecular weight of 402.26 g/mol. Its IUPAC name is (5-iodothiophen-3-yl)-[3-(4-methyl-1,2,4-triazol-3-yl)piperidin-1-yl]methanone.
| Compound Name | (5-iodothiophen-3-yl)-[3-(4-methyl-1,2,4-triazol-3-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 78949850 |
| Molecular Formula | C13H15IN4OS |
| Molecular Weight | 402.26 g/mol |
| Exact Mass | 402.00 |
| IUPAC Name | (5-iodothiophen-3-yl)-[3-(4-methyl-1,2,4-triazol-3-yl)piperidin-1-yl]methanone |
| SMILES | Cn1cnnc1C1CCCN(C(=O)c2csc(I)c2)C1 |
| InChI | InChI=1S/C13H15IN4OS/c1-17-8-15-16-12(17)9-3-2-4-18(6-9)13(19)10-5-11(14)20-7-10/h5,7-9H,2-4,6H2,1H3 |
| InChIKey | IZSUCNNIEUJFKD-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.26 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|