C15H13FINO2S — CID 78950100
[2-(4-fluorophenyl)morpholin-4-yl]-(5-iodothiophen-3-yl)methanone (PubChem CID 78950100) has the molecular formula C15H13FINO2S and a molecular weight of 417.24 g/mol. Its IUPAC name is [2-(4-fluorophenyl)morpholin-4-yl]-(5-iodothiophen-3-yl)methanone.
| Compound Name | [2-(4-fluorophenyl)morpholin-4-yl]-(5-iodothiophen-3-yl)methanone |
|---|---|
| PubChem CID | 78950100 |
| Molecular Formula | C15H13FINO2S |
| Molecular Weight | 417.24 g/mol |
| Exact Mass | 416.97 |
| IUPAC Name | [2-(4-fluorophenyl)morpholin-4-yl]-(5-iodothiophen-3-yl)methanone |
| SMILES | O=C(c1csc(I)c1)N1CCOC(c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C15H13FINO2S/c16-12-3-1-10(2-4-12)13-8-18(5-6-20-13)15(19)11-7-14(17)21-9-11/h1-4,7,9,13H,5-6,8H2 |
| InChIKey | ZGNUSDYRMZMBSI-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.24 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|