C18H20N2O3 — CID 789502
[(2S,6S)-2,6-bis(prop-2-enyl)-3,6-dihydro-2H-pyridin-1-yl]-(2-nitrophenyl)methanone (PubChem CID 789502) has the molecular formula C18H20N2O3 and a molecular weight of 312.37 g/mol. Its IUPAC name is [(2S,6S)-2,6-bis(prop-2-enyl)-3,6-dihydro-2H-pyridin-1-yl]-(2-nitrophenyl)methanone.
| Compound Name | [(2S,6S)-2,6-bis(prop-2-enyl)-3,6-dihydro-2H-pyridin-1-yl]-(2-nitrophenyl)methanone |
|---|---|
| PubChem CID | 789502 |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | [(2S,6S)-2,6-bis(prop-2-enyl)-3,6-dihydro-2H-pyridin-1-yl]-(2-nitrophenyl)methanone |
| SMILES | C=CC[C@H]1CC=C[C@H](CC=C)N1C(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H20N2O3/c1-3-8-14-10-7-11-15(9-4-2)19(14)18(21)16-12-5-6-13-17(16)20(22)23/h3-7,10,12-15H,1-2,8-9,11H2/t14-,15-/m0/s1 |
| InChIKey | NFAXFQGMLZCARZ-GJZGRUSLSA-N |
| XLogP | 3.89 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|