C14H19N3 — CID 78950438
1-(3,5-dimethylphenyl)-N-(1H-pyrazol-4-ylmethyl)ethanamine (PubChem CID 78950438) has the molecular formula C14H19N3 and a molecular weight of 229.33 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-N-(1H-pyrazol-4-ylmethyl)ethanamine.
| Compound Name | 1-(3,5-dimethylphenyl)-N-(1H-pyrazol-4-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 78950438 |
| Molecular Formula | C14H19N3 |
| Molecular Weight | 229.33 g/mol |
| Exact Mass | 229.16 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-N-(1H-pyrazol-4-ylmethyl)ethanamine |
| SMILES | Cc1cc(C)cc(C(C)NCc2cn[nH]c2)c1 |
| InChI | InChI=1S/C14H19N3/c1-10-4-11(2)6-14(5-10)12(3)15-7-13-8-16-17-9-13/h4-6,8-9,12,15H,7H2,1-3H3,(H,16,17) |
| InChIKey | MATAZANWINFRRA-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.33 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |