About 3-(1-cyanopropan-2-yl)-1,1-diethylurea
3-(1-cyanopropan-2-yl)-1,1-diethylurea (PubChem CID 78951301) has the molecular formula C9H17N3O
and a molecular weight of 183.25 g/mol. Its IUPAC name is 3-(1-cyanopropan-2-yl)-1,1-diethylurea.
Molecular Properties
| Compound Name | 3-(1-cyanopropan-2-yl)-1,1-diethylurea |
| PubChem CID | 78951301 |
| Molecular Formula | C9H17N3O |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | 3-(1-cyanopropan-2-yl)-1,1-diethylurea |
| SMILES | CCN(CC)C(=O)NC(C)CC#N |
| InChI | InChI=1S/C9H17N3O/c1-4-12(5-2)9(13)11-8(3)6-7-10/h8H,4-6H2,1-3H3,(H,11,13) |
| InChIKey | NOWIZAZAPACFCC-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(1-cyanopropan-2-yl)-1,1-diethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-cyanopropan-2-yl)-1,1-diethylurea?
The IUPAC name of 3-(1-cyanopropan-2-yl)-1,1-diethylurea (CID 78951301) is 3-(1-cyanopropan-2-yl)-1,1-diethylurea.
What is the SMILES notation for 3-(1-cyanopropan-2-yl)-1,1-diethylurea?
The canonical SMILES for 3-(1-cyanopropan-2-yl)-1,1-diethylurea is CCN(CC)C(=O)NC(C)CC#N.
What is the InChIKey of 3-(1-cyanopropan-2-yl)-1,1-diethylurea?
The InChIKey is NOWIZAZAPACFCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N3O/c1-4-12(5-2)9(13)11-8(3)6-7-10/h8H,4-6H2,1-3H3,(H,11,13).
What are the key properties of 3-(1-cyanopropan-2-yl)-1,1-diethylurea?
3-(1-cyanopropan-2-yl)-1,1-diethylurea has a molecular weight of 183.25 g/mol, XLogP of 1.34, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-cyanopropan-2-yl)-1,1-diethylurea is sourced from PubChem (CID 78951301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).