C13H14N2O4 — CID 78952447
(2S,4R)-4-hydroxy-1-(3-pyridin-3-ylprop-2-enoyl)pyrrolidine-2-carboxylic acid (PubChem CID 78952447) has the molecular formula C13H14N2O4 and a molecular weight of 262.26 g/mol. Its IUPAC name is (2S,4R)-4-hydroxy-1-(3-pyridin-3-ylprop-2-enoyl)pyrrolidine-2-carboxylic acid.
| Compound Name | (2S,4R)-4-hydroxy-1-(3-pyridin-3-ylprop-2-enoyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 78952447 |
| Molecular Formula | C13H14N2O4 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | (2S,4R)-4-hydroxy-1-(3-pyridin-3-ylprop-2-enoyl)pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1C[C@@H](O)CN1C(=O)C=Cc1cccnc1 |
| InChI | InChI=1S/C13H14N2O4/c16-10-6-11(13(18)19)15(8-10)12(17)4-3-9-2-1-5-14-7-9/h1-5,7,10-11,16H,6,8H2,(H,18,19)/t10-,11+/m1/s1 |
| InChIKey | TWVDUOJMBQYUIO-MNOVXSKESA-N |
| XLogP | 0.14 |
| TPSA | 90.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|