About methyl 1-pyrimidin-2-yl-1,2,4-triazole-3-carboxylate
methyl 1-pyrimidin-2-yl-1,2,4-triazole-3-carboxylate (PubChem CID 78953592) has the molecular formula C8H7N5O2
and a molecular weight of 205.18 g/mol. Its IUPAC name is methyl 1-pyrimidin-2-yl-1,2,4-triazole-3-carboxylate.
Molecular Properties
| Compound Name | methyl 1-pyrimidin-2-yl-1,2,4-triazole-3-carboxylate |
| PubChem CID | 78953592 |
| Molecular Formula | C8H7N5O2 |
| Molecular Weight | 205.18 g/mol |
| Exact Mass | 205.06 |
| IUPAC Name | methyl 1-pyrimidin-2-yl-1,2,4-triazole-3-carboxylate |
| SMILES | COC(=O)c1ncn(-c2ncccn2)n1 |
| InChI | InChI=1S/C8H7N5O2/c1-15-7(14)6-11-5-13(12-6)8-9-3-2-4-10-8/h2-5H,1H3 |
| InChIKey | NBCLKNNSTJKNTM-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 82.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.18 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 1-pyrimidin-2-yl-1,2,4-triazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-pyrimidin-2-yl-1,2,4-triazole-3-carboxylate?
The IUPAC name of methyl 1-pyrimidin-2-yl-1,2,4-triazole-3-carboxylate (CID 78953592) is methyl 1-pyrimidin-2-yl-1,2,4-triazole-3-carboxylate.
What is the SMILES notation for methyl 1-pyrimidin-2-yl-1,2,4-triazole-3-carboxylate?
The canonical SMILES for methyl 1-pyrimidin-2-yl-1,2,4-triazole-3-carboxylate is COC(=O)c1ncn(-c2ncccn2)n1.
What is the InChIKey of methyl 1-pyrimidin-2-yl-1,2,4-triazole-3-carboxylate?
The InChIKey is NBCLKNNSTJKNTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N5O2/c1-15-7(14)6-11-5-13(12-6)8-9-3-2-4-10-8/h2-5H,1H3.
What are the key properties of methyl 1-pyrimidin-2-yl-1,2,4-triazole-3-carboxylate?
methyl 1-pyrimidin-2-yl-1,2,4-triazole-3-carboxylate has a molecular weight of 205.18 g/mol, XLogP of -0.16, 2 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-pyrimidin-2-yl-1,2,4-triazole-3-carboxylate is sourced from PubChem (CID 78953592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).