About 4-[(4-cyano-5,6-dimethylpyridazin-3-yl)amino]cyclohexane-1-carboxamide
4-[(4-cyano-5,6-dimethylpyridazin-3-yl)amino]cyclohexane-1-carboxamide (PubChem CID 78954556) has the molecular formula C14H19N5O
and a molecular weight of 273.34 g/mol. Its IUPAC name is 4-[(4-cyano-5,6-dimethylpyridazin-3-yl)amino]cyclohexane-1-carboxamide.
Molecular Properties
| Compound Name | 4-[(4-cyano-5,6-dimethylpyridazin-3-yl)amino]cyclohexane-1-carboxamide |
| PubChem CID | 78954556 |
| Molecular Formula | C14H19N5O |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | 4-[(4-cyano-5,6-dimethylpyridazin-3-yl)amino]cyclohexane-1-carboxamide |
| SMILES | Cc1nnc(NC2CCC(C(N)=O)CC2)c(C#N)c1C |
| InChI | InChI=1S/C14H19N5O/c1-8-9(2)18-19-14(12(8)7-15)17-11-5-3-10(4-6-11)13(16)20/h10-11H,3-6H2,1-2H3,(H2,16,20)(H,17,19) |
| InChIKey | XGSOUNXOCULXAO-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 104.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[(4-cyano-5,6-dimethylpyridazin-3-yl)amino]cyclohexane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4-cyano-5,6-dimethylpyridazin-3-yl)amino]cyclohexane-1-carboxamide?
The IUPAC name of 4-[(4-cyano-5,6-dimethylpyridazin-3-yl)amino]cyclohexane-1-carboxamide (CID 78954556) is 4-[(4-cyano-5,6-dimethylpyridazin-3-yl)amino]cyclohexane-1-carboxamide.
What is the SMILES notation for 4-[(4-cyano-5,6-dimethylpyridazin-3-yl)amino]cyclohexane-1-carboxamide?
The canonical SMILES for 4-[(4-cyano-5,6-dimethylpyridazin-3-yl)amino]cyclohexane-1-carboxamide is Cc1nnc(NC2CCC(C(N)=O)CC2)c(C#N)c1C.
What is the InChIKey of 4-[(4-cyano-5,6-dimethylpyridazin-3-yl)amino]cyclohexane-1-carboxamide?
The InChIKey is XGSOUNXOCULXAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N5O/c1-8-9(2)18-19-14(12(8)7-15)17-11-5-3-10(4-6-11)13(16)20/h10-11H,3-6H2,1-2H3,(H2,16,20)(H,17,19).
What are the key properties of 4-[(4-cyano-5,6-dimethylpyridazin-3-yl)amino]cyclohexane-1-carboxamide?
4-[(4-cyano-5,6-dimethylpyridazin-3-yl)amino]cyclohexane-1-carboxamide has a molecular weight of 273.34 g/mol, XLogP of 1.42, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4-cyano-5,6-dimethylpyridazin-3-yl)amino]cyclohexane-1-carboxamide is sourced from PubChem (CID 78954556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).