About N-[(1,4-dimethylpiperazin-2-yl)methyl]pyrido[2,3-b]pyrazin-6-amine
N-[(1,4-dimethylpiperazin-2-yl)methyl]pyrido[2,3-b]pyrazin-6-amine (PubChem CID 78954799) has the molecular formula C14H20N6
and a molecular weight of 272.36 g/mol. Its IUPAC name is N-[(1,4-dimethylpiperazin-2-yl)methyl]pyrido[2,3-b]pyrazin-6-amine.
Molecular Properties
| Compound Name | N-[(1,4-dimethylpiperazin-2-yl)methyl]pyrido[2,3-b]pyrazin-6-amine |
| PubChem CID | 78954799 |
| Molecular Formula | C14H20N6 |
| Molecular Weight | 272.36 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | N-[(1,4-dimethylpiperazin-2-yl)methyl]pyrido[2,3-b]pyrazin-6-amine |
| SMILES | CN1CCN(C)C(CNc2ccc3nccnc3n2)C1 |
| InChI | InChI=1S/C14H20N6/c1-19-7-8-20(2)11(10-19)9-17-13-4-3-12-14(18-13)16-6-5-15-12/h3-6,11H,7-10H2,1-2H3,(H,16,17,18) |
| InChIKey | JECDAKREKBEXQG-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.36 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[(1,4-dimethylpiperazin-2-yl)methyl]pyrido[2,3-b]pyrazin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1,4-dimethylpiperazin-2-yl)methyl]pyrido[2,3-b]pyrazin-6-amine?
The IUPAC name of N-[(1,4-dimethylpiperazin-2-yl)methyl]pyrido[2,3-b]pyrazin-6-amine (CID 78954799) is N-[(1,4-dimethylpiperazin-2-yl)methyl]pyrido[2,3-b]pyrazin-6-amine.
What is the SMILES notation for N-[(1,4-dimethylpiperazin-2-yl)methyl]pyrido[2,3-b]pyrazin-6-amine?
The canonical SMILES for N-[(1,4-dimethylpiperazin-2-yl)methyl]pyrido[2,3-b]pyrazin-6-amine is CN1CCN(C)C(CNc2ccc3nccnc3n2)C1.
What is the InChIKey of N-[(1,4-dimethylpiperazin-2-yl)methyl]pyrido[2,3-b]pyrazin-6-amine?
The InChIKey is JECDAKREKBEXQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N6/c1-19-7-8-20(2)11(10-19)9-17-13-4-3-12-14(18-13)16-6-5-15-12/h3-6,11H,7-10H2,1-2H3,(H,16,17,18).
What are the key properties of N-[(1,4-dimethylpiperazin-2-yl)methyl]pyrido[2,3-b]pyrazin-6-amine?
N-[(1,4-dimethylpiperazin-2-yl)methyl]pyrido[2,3-b]pyrazin-6-amine has a molecular weight of 272.36 g/mol, XLogP of 0.68, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1,4-dimethylpiperazin-2-yl)methyl]pyrido[2,3-b]pyrazin-6-amine is sourced from PubChem (CID 78954799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).