About methyl 1-(2-hydroxyethyl)-1,2,4-triazole-3-carboxylate
methyl 1-(2-hydroxyethyl)-1,2,4-triazole-3-carboxylate (PubChem CID 78955701) has the molecular formula C6H9N3O3
and a molecular weight of 171.16 g/mol. Its IUPAC name is methyl 1-(2-hydroxyethyl)-1,2,4-triazole-3-carboxylate.
Molecular Properties
| Compound Name | methyl 1-(2-hydroxyethyl)-1,2,4-triazole-3-carboxylate |
| PubChem CID | 78955701 |
| Molecular Formula | C6H9N3O3 |
| Molecular Weight | 171.16 g/mol |
| Exact Mass | 171.06 |
| IUPAC Name | methyl 1-(2-hydroxyethyl)-1,2,4-triazole-3-carboxylate |
| SMILES | COC(=O)c1ncn(CCO)n1 |
| InChI | InChI=1S/C6H9N3O3/c1-12-6(11)5-7-4-9(8-5)2-3-10/h4,10H,2-3H2,1H3 |
| InChIKey | LPXVRHURTKHCFA-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.16 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 1-(2-hydroxyethyl)-1,2,4-triazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-(2-hydroxyethyl)-1,2,4-triazole-3-carboxylate?
The IUPAC name of methyl 1-(2-hydroxyethyl)-1,2,4-triazole-3-carboxylate (CID 78955701) is methyl 1-(2-hydroxyethyl)-1,2,4-triazole-3-carboxylate.
What is the SMILES notation for methyl 1-(2-hydroxyethyl)-1,2,4-triazole-3-carboxylate?
The canonical SMILES for methyl 1-(2-hydroxyethyl)-1,2,4-triazole-3-carboxylate is COC(=O)c1ncn(CCO)n1.
What is the InChIKey of methyl 1-(2-hydroxyethyl)-1,2,4-triazole-3-carboxylate?
The InChIKey is LPXVRHURTKHCFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3O3/c1-12-6(11)5-7-4-9(8-5)2-3-10/h4,10H,2-3H2,1H3.
What are the key properties of methyl 1-(2-hydroxyethyl)-1,2,4-triazole-3-carboxylate?
methyl 1-(2-hydroxyethyl)-1,2,4-triazole-3-carboxylate has a molecular weight of 171.16 g/mol, XLogP of -0.94, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-(2-hydroxyethyl)-1,2,4-triazole-3-carboxylate is sourced from PubChem (CID 78955701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).