About N-(2-methyl-3-methylsulfanylpropyl)tetrazolo[1,5-b]pyridazin-6-amine
N-(2-methyl-3-methylsulfanylpropyl)tetrazolo[1,5-b]pyridazin-6-amine (PubChem CID 78957763) has the molecular formula C9H14N6S
and a molecular weight of 238.32 g/mol. Its IUPAC name is N-(2-methyl-3-methylsulfanylpropyl)tetrazolo[1,5-b]pyridazin-6-amine.
Molecular Properties
| Compound Name | N-(2-methyl-3-methylsulfanylpropyl)tetrazolo[1,5-b]pyridazin-6-amine |
| PubChem CID | 78957763 |
| Molecular Formula | C9H14N6S |
| Molecular Weight | 238.32 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | N-(2-methyl-3-methylsulfanylpropyl)tetrazolo[1,5-b]pyridazin-6-amine |
| SMILES | CSCC(C)CNc1ccc2nnnn2n1 |
| InChI | InChI=1S/C9H14N6S/c1-7(6-16-2)5-10-8-3-4-9-11-13-14-15(9)12-8/h3-4,7H,5-6H2,1-2H3,(H,10,12) |
| InChIKey | MFNUQKZTMOBIMN-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 68.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.32 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-(2-methyl-3-methylsulfanylpropyl)tetrazolo[1,5-b]pyridazin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-methyl-3-methylsulfanylpropyl)tetrazolo[1,5-b]pyridazin-6-amine?
The IUPAC name of N-(2-methyl-3-methylsulfanylpropyl)tetrazolo[1,5-b]pyridazin-6-amine (CID 78957763) is N-(2-methyl-3-methylsulfanylpropyl)tetrazolo[1,5-b]pyridazin-6-amine.
What is the SMILES notation for N-(2-methyl-3-methylsulfanylpropyl)tetrazolo[1,5-b]pyridazin-6-amine?
The canonical SMILES for N-(2-methyl-3-methylsulfanylpropyl)tetrazolo[1,5-b]pyridazin-6-amine is CSCC(C)CNc1ccc2nnnn2n1.
What is the InChIKey of N-(2-methyl-3-methylsulfanylpropyl)tetrazolo[1,5-b]pyridazin-6-amine?
The InChIKey is MFNUQKZTMOBIMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N6S/c1-7(6-16-2)5-10-8-3-4-9-11-13-14-15(9)12-8/h3-4,7H,5-6H2,1-2H3,(H,10,12).
What are the key properties of N-(2-methyl-3-methylsulfanylpropyl)tetrazolo[1,5-b]pyridazin-6-amine?
N-(2-methyl-3-methylsulfanylpropyl)tetrazolo[1,5-b]pyridazin-6-amine has a molecular weight of 238.32 g/mol, XLogP of 0.93, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-methyl-3-methylsulfanylpropyl)tetrazolo[1,5-b]pyridazin-6-amine is sourced from PubChem (CID 78957763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).