C11H21F3N2O3 — CID 78957904
N-(2-methoxyethyl)-N-(3-methoxypropyl)-2-(2,2,2-trifluoroethylamino)acetamide (PubChem CID 78957904) has the molecular formula C11H21F3N2O3 and a molecular weight of 286.29 g/mol. Its IUPAC name is N-(2-methoxyethyl)-N-(3-methoxypropyl)-2-(2,2,2-trifluoroethylamino)acetamide.
| Compound Name | N-(2-methoxyethyl)-N-(3-methoxypropyl)-2-(2,2,2-trifluoroethylamino)acetamide |
|---|---|
| PubChem CID | 78957904 |
| Molecular Formula | C11H21F3N2O3 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | N-(2-methoxyethyl)-N-(3-methoxypropyl)-2-(2,2,2-trifluoroethylamino)acetamide |
| SMILES | COCCCN(CCOC)C(=O)CNCC(F)(F)F |
| InChI | InChI=1S/C11H21F3N2O3/c1-18-6-3-4-16(5-7-19-2)10(17)8-15-9-11(12,13)14/h15H,3-9H2,1-2H3 |
| InChIKey | JETWPSLYAWNGTF-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|