C10H18F3N3O2 — CID 78957978
2-methyl-N-[2-[[2-(2,2,2-trifluoroethylamino)acetyl]amino]ethyl]propanamide (PubChem CID 78957978) has the molecular formula C10H18F3N3O2 and a molecular weight of 269.27 g/mol. Its IUPAC name is 2-methyl-N-[2-[[2-(2,2,2-trifluoroethylamino)acetyl]amino]ethyl]propanamide.
| Compound Name | 2-methyl-N-[2-[[2-(2,2,2-trifluoroethylamino)acetyl]amino]ethyl]propanamide |
|---|---|
| PubChem CID | 78957978 |
| Molecular Formula | C10H18F3N3O2 |
| Molecular Weight | 269.27 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 2-methyl-N-[2-[[2-(2,2,2-trifluoroethylamino)acetyl]amino]ethyl]propanamide |
| SMILES | CC(C)C(=O)NCCNC(=O)CNCC(F)(F)F |
| InChI | InChI=1S/C10H18F3N3O2/c1-7(2)9(18)16-4-3-15-8(17)5-14-6-10(11,12)13/h7,14H,3-6H2,1-2H3,(H,15,17)(H,16,18) |
| InChIKey | GMJLUXUEBMJLFD-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.27 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|