C7H14F3N3O3S — CID 78958022
N-[2-(methanesulfonamido)ethyl]-2-(2,2,2-trifluoroethylamino)acetamide (PubChem CID 78958022) has the molecular formula C7H14F3N3O3S and a molecular weight of 277.27 g/mol. Its IUPAC name is N-[2-(methanesulfonamido)ethyl]-2-(2,2,2-trifluoroethylamino)acetamide.
| Compound Name | N-[2-(methanesulfonamido)ethyl]-2-(2,2,2-trifluoroethylamino)acetamide |
|---|---|
| PubChem CID | 78958022 |
| Molecular Formula | C7H14F3N3O3S |
| Molecular Weight | 277.27 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | N-[2-(methanesulfonamido)ethyl]-2-(2,2,2-trifluoroethylamino)acetamide |
| SMILES | CS(=O)(=O)NCCNC(=O)CNCC(F)(F)F |
| InChI | InChI=1S/C7H14F3N3O3S/c1-17(15,16)13-3-2-12-6(14)4-11-5-7(8,9)10/h11,13H,2-5H2,1H3,(H,12,14) |
| InChIKey | XETLZWWCFJDXRT-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.27 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|