C7H10F2N2O — CID 78958703
4-(2,2-difluoroethyl)morpholine-2-carbonitrile (PubChem CID 78958703) has the molecular formula C7H10F2N2O and a molecular weight of 176.17 g/mol. Its IUPAC name is 4-(2,2-difluoroethyl)morpholine-2-carbonitrile.
| Compound Name | 4-(2,2-difluoroethyl)morpholine-2-carbonitrile |
|---|---|
| PubChem CID | 78958703 |
| Molecular Formula | C7H10F2N2O |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | 4-(2,2-difluoroethyl)morpholine-2-carbonitrile |
| SMILES | N#CC1CN(CC(F)F)CCO1 |
| InChI | InChI=1S/C7H10F2N2O/c8-7(9)5-11-1-2-12-6(3-10)4-11/h6-7H,1-2,4-5H2 |
| InChIKey | SMTZZEXKWPDYCI-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |