C15H14ClF2NO — CID 78960006
3-chloro-2-[[1-(2,5-difluorophenyl)ethylamino]methyl]phenol (PubChem CID 78960006) has the molecular formula C15H14ClF2NO and a molecular weight of 297.73 g/mol. Its IUPAC name is 3-chloro-2-[[1-(2,5-difluorophenyl)ethylamino]methyl]phenol.
| Compound Name | 3-chloro-2-[[1-(2,5-difluorophenyl)ethylamino]methyl]phenol |
|---|---|
| PubChem CID | 78960006 |
| Molecular Formula | C15H14ClF2NO |
| Molecular Weight | 297.73 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 3-chloro-2-[[1-(2,5-difluorophenyl)ethylamino]methyl]phenol |
| SMILES | CC(NCc1c(O)cccc1Cl)c1cc(F)ccc1F |
| InChI | InChI=1S/C15H14ClF2NO/c1-9(11-7-10(17)5-6-14(11)18)19-8-12-13(16)3-2-4-15(12)20/h2-7,9,19-20H,8H2,1H3 |
| InChIKey | RWLALLZYGXLMHK-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.73 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|