About 6-methyl-2-[(4-methyl-1,2,5-oxadiazol-3-yl)methylsulfanyl]pyrimidin-4-amine
6-methyl-2-[(4-methyl-1,2,5-oxadiazol-3-yl)methylsulfanyl]pyrimidin-4-amine (PubChem CID 78961995) has the molecular formula C9H11N5OS
and a molecular weight of 237.29 g/mol. Its IUPAC name is 6-methyl-2-[(4-methyl-1,2,5-oxadiazol-3-yl)methylsulfanyl]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 6-methyl-2-[(4-methyl-1,2,5-oxadiazol-3-yl)methylsulfanyl]pyrimidin-4-amine |
| PubChem CID | 78961995 |
| Molecular Formula | C9H11N5OS |
| Molecular Weight | 237.29 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | 6-methyl-2-[(4-methyl-1,2,5-oxadiazol-3-yl)methylsulfanyl]pyrimidin-4-amine |
| SMILES | Cc1cc(N)nc(SCc2nonc2C)n1 |
| InChI | InChI=1S/C9H11N5OS/c1-5-3-8(10)12-9(11-5)16-4-7-6(2)13-15-14-7/h3H,4H2,1-2H3,(H2,10,11,12) |
| InChIKey | XHZIGBWJNAHWJO-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 90.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.29 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 6-methyl-2-[(4-methyl-1,2,5-oxadiazol-3-yl)methylsulfanyl]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-2-[(4-methyl-1,2,5-oxadiazol-3-yl)methylsulfanyl]pyrimidin-4-amine?
The IUPAC name of 6-methyl-2-[(4-methyl-1,2,5-oxadiazol-3-yl)methylsulfanyl]pyrimidin-4-amine (CID 78961995) is 6-methyl-2-[(4-methyl-1,2,5-oxadiazol-3-yl)methylsulfanyl]pyrimidin-4-amine.
What is the SMILES notation for 6-methyl-2-[(4-methyl-1,2,5-oxadiazol-3-yl)methylsulfanyl]pyrimidin-4-amine?
The canonical SMILES for 6-methyl-2-[(4-methyl-1,2,5-oxadiazol-3-yl)methylsulfanyl]pyrimidin-4-amine is Cc1cc(N)nc(SCc2nonc2C)n1.
What is the InChIKey of 6-methyl-2-[(4-methyl-1,2,5-oxadiazol-3-yl)methylsulfanyl]pyrimidin-4-amine?
The InChIKey is XHZIGBWJNAHWJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N5OS/c1-5-3-8(10)12-9(11-5)16-4-7-6(2)13-15-14-7/h3H,4H2,1-2H3,(H2,10,11,12).
What are the key properties of 6-methyl-2-[(4-methyl-1,2,5-oxadiazol-3-yl)methylsulfanyl]pyrimidin-4-amine?
6-methyl-2-[(4-methyl-1,2,5-oxadiazol-3-yl)methylsulfanyl]pyrimidin-4-amine has a molecular weight of 237.29 g/mol, XLogP of 1.35, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-2-[(4-methyl-1,2,5-oxadiazol-3-yl)methylsulfanyl]pyrimidin-4-amine is sourced from PubChem (CID 78961995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).