C10H21NO4S — CID 78963284
[3-[2-(2-methoxyethoxy)ethyl]-1,1-dioxothiolan-3-yl]methanamine (PubChem CID 78963284) has the molecular formula C10H21NO4S and a molecular weight of 251.35 g/mol. Its IUPAC name is [3-[2-(2-methoxyethoxy)ethyl]-1,1-dioxothiolan-3-yl]methanamine.
| Compound Name | [3-[2-(2-methoxyethoxy)ethyl]-1,1-dioxothiolan-3-yl]methanamine |
|---|---|
| PubChem CID | 78963284 |
| Molecular Formula | C10H21NO4S |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | [3-[2-(2-methoxyethoxy)ethyl]-1,1-dioxothiolan-3-yl]methanamine |
| SMILES | COCCOCCC1(CN)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H21NO4S/c1-14-5-6-15-4-2-10(8-11)3-7-16(12,13)9-10/h2-9,11H2,1H3 |
| InChIKey | AQARLYPUJXSRPZ-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|