About (3R)-1-(2,2-difluoroethyl)pyrrolidin-3-ol
(3R)-1-(2,2-difluoroethyl)pyrrolidin-3-ol (PubChem CID 78963709) has the molecular formula C6H11F2NO
and a molecular weight of 151.16 g/mol. Its IUPAC name is (3R)-1-(2,2-difluoroethyl)pyrrolidin-3-ol.
Molecular Properties
| Compound Name | (3R)-1-(2,2-difluoroethyl)pyrrolidin-3-ol |
| PubChem CID | 78963709 |
| Molecular Formula | C6H11F2NO |
| Molecular Weight | 151.16 g/mol |
| Exact Mass | 151.08 |
| IUPAC Name | (3R)-1-(2,2-difluoroethyl)pyrrolidin-3-ol |
| SMILES | O[C@@H]1CCN(CC(F)F)C1 |
| InChI | InChI=1S/C6H11F2NO/c7-6(8)4-9-2-1-5(10)3-9/h5-6,10H,1-4H2/t5-/m1/s1 |
| InChIKey | GLSFKVZLDBCSSQ-RXMQYKEDSA-N |
| XLogP | 0.32 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.16 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3R)-1-(2,2-difluoroethyl)pyrrolidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-1-(2,2-difluoroethyl)pyrrolidin-3-ol?
The IUPAC name of (3R)-1-(2,2-difluoroethyl)pyrrolidin-3-ol (CID 78963709) is (3R)-1-(2,2-difluoroethyl)pyrrolidin-3-ol.
What is the SMILES notation for (3R)-1-(2,2-difluoroethyl)pyrrolidin-3-ol?
The canonical SMILES for (3R)-1-(2,2-difluoroethyl)pyrrolidin-3-ol is O[C@@H]1CCN(CC(F)F)C1.
What is the InChIKey of (3R)-1-(2,2-difluoroethyl)pyrrolidin-3-ol?
The InChIKey is GLSFKVZLDBCSSQ-RXMQYKEDSA-N. The full InChI is InChI=1S/C6H11F2NO/c7-6(8)4-9-2-1-5(10)3-9/h5-6,10H,1-4H2/t5-/m1/s1.
What are the key properties of (3R)-1-(2,2-difluoroethyl)pyrrolidin-3-ol?
(3R)-1-(2,2-difluoroethyl)pyrrolidin-3-ol has a molecular weight of 151.16 g/mol, XLogP of 0.32, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-1-(2,2-difluoroethyl)pyrrolidin-3-ol is sourced from PubChem (CID 78963709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).