C15H26N2OS — CID 78963769
N-(2-methylpropyl)-2-[(2-methyl-2-thiophen-2-ylpropyl)amino]propanamide (PubChem CID 78963769) has the molecular formula C15H26N2OS and a molecular weight of 282.45 g/mol. Its IUPAC name is N-(2-methylpropyl)-2-[(2-methyl-2-thiophen-2-ylpropyl)amino]propanamide.
| Compound Name | N-(2-methylpropyl)-2-[(2-methyl-2-thiophen-2-ylpropyl)amino]propanamide |
|---|---|
| PubChem CID | 78963769 |
| Molecular Formula | C15H26N2OS |
| Molecular Weight | 282.45 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | N-(2-methylpropyl)-2-[(2-methyl-2-thiophen-2-ylpropyl)amino]propanamide |
| SMILES | CC(C)CNC(=O)C(C)NCC(C)(C)c1cccs1 |
| InChI | InChI=1S/C15H26N2OS/c1-11(2)9-16-14(18)12(3)17-10-15(4,5)13-7-6-8-19-13/h6-8,11-12,17H,9-10H2,1-5H3,(H,16,18) |
| InChIKey | XOVJYWIVBDMESG-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.45 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |