About methyl 3-[3,3-dimethylbutyl(oxolan-2-ylmethyl)amino]propanoate
methyl 3-[3,3-dimethylbutyl(oxolan-2-ylmethyl)amino]propanoate (PubChem CID 78964574) has the molecular formula C15H29NO3
and a molecular weight of 271.40 g/mol. Its IUPAC name is methyl 3-[3,3-dimethylbutyl(oxolan-2-ylmethyl)amino]propanoate.
Analyze methyl 3-[3,3-dimethylbutyl(oxolan-2-ylmethyl)amino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[3,3-dimethylbutyl(oxolan-2-ylmethyl)amino]propanoate?
The IUPAC name of methyl 3-[3,3-dimethylbutyl(oxolan-2-ylmethyl)amino]propanoate (CID 78964574) is methyl 3-[3,3-dimethylbutyl(oxolan-2-ylmethyl)amino]propanoate.
What is the SMILES notation for methyl 3-[3,3-dimethylbutyl(oxolan-2-ylmethyl)amino]propanoate?
The canonical SMILES for methyl 3-[3,3-dimethylbutyl(oxolan-2-ylmethyl)amino]propanoate is COC(=O)CCN(CCC(C)(C)C)CC1CCCO1.
What is the InChIKey of methyl 3-[3,3-dimethylbutyl(oxolan-2-ylmethyl)amino]propanoate?
The InChIKey is LQFMLFSQIMPGJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H29NO3/c1-15(2,3)8-10-16(9-7-14(17)18-4)12-13-6-5-11-19-13/h13H,5-12H2,1-4H3.
What are the key properties of methyl 3-[3,3-dimethylbutyl(oxolan-2-ylmethyl)amino]propanoate?
methyl 3-[3,3-dimethylbutyl(oxolan-2-ylmethyl)amino]propanoate has a molecular weight of 271.40 g/mol, XLogP of 2.47, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[3,3-dimethylbutyl(oxolan-2-ylmethyl)amino]propanoate is sourced from PubChem (CID 78964574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).