C15H26N2O — CID 78967379
2-(4-tert-butylazepan-1-yl)-N-prop-2-ynylacetamide (PubChem CID 78967379) has the molecular formula C15H26N2O and a molecular weight of 250.39 g/mol. Its IUPAC name is 2-(4-tert-butylazepan-1-yl)-N-prop-2-ynylacetamide.
| Compound Name | 2-(4-tert-butylazepan-1-yl)-N-prop-2-ynylacetamide |
|---|---|
| PubChem CID | 78967379 |
| Molecular Formula | C15H26N2O |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.20 |
| IUPAC Name | 2-(4-tert-butylazepan-1-yl)-N-prop-2-ynylacetamide |
| SMILES | C#CCNC(=O)CN1CCCC(C(C)(C)C)CC1 |
| InChI | InChI=1S/C15H26N2O/c1-5-9-16-14(18)12-17-10-6-7-13(8-11-17)15(2,3)4/h1,13H,6-12H2,2-4H3,(H,16,18) |
| InChIKey | RFTIKVAJLAMJAY-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|