C9H18N2O3 — CID 78967405
2-[(4-methylmorpholin-2-yl)methylamino]propanoic acid (PubChem CID 78967405) has the molecular formula C9H18N2O3 and a molecular weight of 202.25 g/mol. Its IUPAC name is 2-[(4-methylmorpholin-2-yl)methylamino]propanoic acid.
| Compound Name | 2-[(4-methylmorpholin-2-yl)methylamino]propanoic acid |
|---|---|
| PubChem CID | 78967405 |
| Molecular Formula | C9H18N2O3 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.13 |
| IUPAC Name | 2-[(4-methylmorpholin-2-yl)methylamino]propanoic acid |
| SMILES | CC(NCC1CN(C)CCO1)C(=O)O |
| InChI | InChI=1S/C9H18N2O3/c1-7(9(12)13)10-5-8-6-11(2)3-4-14-8/h7-8,10H,3-6H2,1-2H3,(H,12,13) |
| InChIKey | HOXPXHBGDKSKAU-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |