C11H10N4O3 — CID 78969246
methyl 2-(2H-triazole-4-carbonylamino)benzoate (PubChem CID 78969246) has the molecular formula C11H10N4O3 and a molecular weight of 246.23 g/mol. Its IUPAC name is methyl 2-(2H-triazole-4-carbonylamino)benzoate.
| Compound Name | methyl 2-(2H-triazole-4-carbonylamino)benzoate |
|---|---|
| PubChem CID | 78969246 |
| Molecular Formula | C11H10N4O3 |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | methyl 2-(2H-triazole-4-carbonylamino)benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)c1cn[nH]n1 |
| InChI | InChI=1S/C11H10N4O3/c1-18-11(17)7-4-2-3-5-8(7)13-10(16)9-6-12-15-14-9/h2-6H,1H3,(H,13,16)(H,12,14,15) |
| InChIKey | BGDQLWFTJKBIHC-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |